C24H29NO3S — CID 59994086
(5Z)-5-[(4-decoxynaphthalen-1-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 59994086) has the molecular formula C24H29NO3S and a molecular weight of 411.57 g/mol. Its IUPAC name is (5Z)-5-[(4-decoxynaphthalen-1-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(4-decoxynaphthalen-1-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 59994086 |
| Molecular Formula | C24H29NO3S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (5Z)-5-[(4-decoxynaphthalen-1-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCCCCCCCOc1ccc(/C=C2\SC(=O)NC2=O)c2ccccc12 |
| InChI | InChI=1S/C24H29NO3S/c1-2-3-4-5-6-7-8-11-16-28-21-15-14-18(19-12-9-10-13-20(19)21)17-22-23(26)25-24(27)29-22/h9-10,12-15,17H,2-8,11,16H2,1H3,(H,25,26,27)/b22-17- |
| InChIKey | CPIVNLSCERTQSW-XLNRJJMWSA-N |
| XLogP | 6.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|