C15H12N2O4S — CID 59122793
3-[3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]propanoic acid (PubChem CID 59122793) has the molecular formula C15H12N2O4S and a molecular weight of 316.34 g/mol. Its IUPAC name is 3-[3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]propanoic acid.
| Compound Name | 3-[3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 59122793 |
| Molecular Formula | C15H12N2O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 3-[3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1cc(/C=C2\SC(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C15H12N2O4S/c18-13(19)5-6-17-8-9(10-3-1-2-4-11(10)17)7-12-14(20)16-15(21)22-12/h1-4,7-8H,5-6H2,(H,18,19)(H,16,20,21)/b12-7- |
| InChIKey | KMRHTTIIGJDFJC-GHXNOFRVSA-N |
| XLogP | 2.44 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|