C21H16ClN3O3S — CID 57489786
N-[(4-chlorophenyl)methyl]-2-[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetamide (PubChem CID 57489786) has the molecular formula C21H16ClN3O3S and a molecular weight of 425.90 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 57489786 |
| Molecular Formula | C21H16ClN3O3S |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(/C=C2/SC(=O)NC2=O)c2ccccc21)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16ClN3O3S/c22-15-7-5-13(6-8-15)10-23-19(26)12-25-11-14(16-3-1-2-4-17(16)25)9-18-20(27)24-21(28)29-18/h1-9,11H,10,12H2,(H,23,26)(H,24,27,28)/b18-9+ |
| InChIKey | NFTVENFBGUITPH-GIJQJNRQSA-N |
| XLogP | 3.93 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|