C29H24N4O4 — CID 1265951
N-benzyl-2-[3-[(Z)-(1-benzyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]indol-1-yl]acetamide (PubChem CID 1265951) has the molecular formula C29H24N4O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is N-benzyl-2-[3-[(Z)-(1-benzyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]indol-1-yl]acetamide.
| Compound Name | N-benzyl-2-[3-[(Z)-(1-benzyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 1265951 |
| Molecular Formula | C29H24N4O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | N-benzyl-2-[3-[(Z)-(1-benzyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]indol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(/C=C2/C(=O)NC(=O)N(Cc3ccccc3)C2=O)c2ccccc21)NCc1ccccc1 |
| InChI | InChI=1S/C29H24N4O4/c34-26(30-16-20-9-3-1-4-10-20)19-32-18-22(23-13-7-8-14-25(23)32)15-24-27(35)31-29(37)33(28(24)36)17-21-11-5-2-6-12-21/h1-15,18H,16-17,19H2,(H,30,34)(H,31,35,37)/b24-15- |
| InChIKey | JCDGWXFVTONOKW-IWIPYMOSSA-N |
| XLogP | 3.62 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|