C29H27N3O2 — CID 73159721
2-[3-[(2-oxo-1H-indol-3-ylidene)methyl]indol-1-yl]-N-(4-phenylbutyl)acetamide (PubChem CID 73159721) has the molecular formula C29H27N3O2 and a molecular weight of 449.55 g/mol. Its IUPAC name is 2-[3-[(2-oxo-1H-indol-3-ylidene)methyl]indol-1-yl]-N-(4-phenylbutyl)acetamide.
| Compound Name | 2-[3-[(2-oxo-1H-indol-3-ylidene)methyl]indol-1-yl]-N-(4-phenylbutyl)acetamide |
|---|---|
| PubChem CID | 73159721 |
| Molecular Formula | C29H27N3O2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 2-[3-[(2-oxo-1H-indol-3-ylidene)methyl]indol-1-yl]-N-(4-phenylbutyl)acetamide |
| SMILES | O=C(Cn1cc(C=C2C(=O)Nc3ccccc32)c2ccccc21)NCCCCc1ccccc1 |
| InChI | InChI=1S/C29H27N3O2/c33-28(30-17-9-8-12-21-10-2-1-3-11-21)20-32-19-22(23-13-5-7-16-27(23)32)18-25-24-14-4-6-15-26(24)31-29(25)34/h1-7,10-11,13-16,18-19H,8-9,12,17,20H2,(H,30,33)(H,31,34) |
| InChIKey | GVVWUVKHWLMESZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|