C33H25N3O3 — CID 155810643
10-[(2R)-2-hydroxy-3-[3-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]indol-1-yl]propyl]acridin-9-one (PubChem CID 155810643) has the molecular formula C33H25N3O3 and a molecular weight of 511.58 g/mol. Its IUPAC name is 10-[(2R)-2-hydroxy-3-[3-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]indol-1-yl]propyl]acridin-9-one.
| Compound Name | 10-[(2R)-2-hydroxy-3-[3-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]indol-1-yl]propyl]acridin-9-one |
|---|---|
| PubChem CID | 155810643 |
| Molecular Formula | C33H25N3O3 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 10-[(2R)-2-hydroxy-3-[3-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]indol-1-yl]propyl]acridin-9-one |
| SMILES | O=C1Nc2ccccc2/C1=C/c1cn(C[C@@H](O)Cn2c3ccccc3c(=O)c3ccccc32)c2ccccc12 |
| InChI | InChI=1S/C33H25N3O3/c37-22(20-36-30-15-7-3-11-25(30)32(38)26-12-4-8-16-31(26)36)19-35-18-21(23-9-2-6-14-29(23)35)17-27-24-10-1-5-13-28(24)34-33(27)39/h1-18,22,37H,19-20H2,(H,34,39)/b27-17-/t22-/m1/s1 |
| InChIKey | DTINRFLXDFJJLM-AWXAQXEGSA-N |
| XLogP | 5.66 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|