C24H24N4O2 — CID 143304674
(3Z)-3-[[1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-1H-indol-2-one (PubChem CID 143304674) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is (3Z)-3-[[1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-3-[[1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 143304674 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (3Z)-3-[[1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-1H-indol-2-one |
| SMILES | CN1CCN(C(=O)Cn2cc(/C=C3\C(=O)Nc4ccccc43)c3ccccc32)CC1 |
| InChI | InChI=1S/C24H24N4O2/c1-26-10-12-27(13-11-26)23(29)16-28-15-17(18-6-3-5-9-22(18)28)14-20-19-7-2-4-8-21(19)25-24(20)30/h2-9,14-15H,10-13,16H2,1H3,(H,25,30)/b20-14- |
| InChIKey | FBQLOHLPBVCWIS-ZHZULCJRSA-N |
| XLogP | 2.91 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|