C26H24F3N3O2 — CID 21374196
(3E)-3-[[1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 21374196) has the molecular formula C26H24F3N3O2 and a molecular weight of 467.49 g/mol. Its IUPAC name is (3E)-3-[[1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3E)-3-[[1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 21374196 |
| Molecular Formula | C26H24F3N3O2 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | (3E)-3-[[1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | CC1CCN(C(=O)Cn2cc(/C=C3/C(=O)Nc4cc(C(F)(F)F)ccc43)c3ccccc32)CC1 |
| InChI | InChI=1S/C26H24F3N3O2/c1-16-8-10-31(11-9-16)24(33)15-32-14-17(19-4-2-3-5-23(19)32)12-21-20-7-6-18(26(27,28)29)13-22(20)30-25(21)34/h2-7,12-14,16H,8-11,15H2,1H3,(H,30,34)/b21-12+ |
| InChIKey | DBVLLAKNYKDQDQ-CIAFOILYSA-N |
| XLogP | 5.41 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|