C27H21F3N2O2 — CID 21374021
(3E)-3-[[1-(3-phenoxypropyl)indol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 21374021) has the molecular formula C27H21F3N2O2 and a molecular weight of 462.47 g/mol. Its IUPAC name is (3E)-3-[[1-(3-phenoxypropyl)indol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3E)-3-[[1-(3-phenoxypropyl)indol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 21374021 |
| Molecular Formula | C27H21F3N2O2 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | (3E)-3-[[1-(3-phenoxypropyl)indol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | O=C1Nc2cc(C(F)(F)F)ccc2/C1=C\c1cn(CCCOc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C27H21F3N2O2/c28-27(29,30)19-11-12-22-23(26(33)31-24(22)16-19)15-18-17-32(25-10-5-4-9-21(18)25)13-6-14-34-20-7-2-1-3-8-20/h1-5,7-12,15-17H,6,13-14H2,(H,31,33)/b23-15+ |
| InChIKey | XLYAMKJISHDWHY-HZHRSRAPSA-N |
| XLogP | 6.62 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|