C28H23F3N2O2 — CID 21374105
(3E)-3-[[1-[2-(3,4-dimethylphenoxy)ethyl]indol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 21374105) has the molecular formula C28H23F3N2O2 and a molecular weight of 476.50 g/mol. Its IUPAC name is (3E)-3-[[1-[2-(3,4-dimethylphenoxy)ethyl]indol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3E)-3-[[1-[2-(3,4-dimethylphenoxy)ethyl]indol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 21374105 |
| Molecular Formula | C28H23F3N2O2 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | (3E)-3-[[1-[2-(3,4-dimethylphenoxy)ethyl]indol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | Cc1ccc(OCCn2cc(/C=C3/C(=O)Nc4cc(C(F)(F)F)ccc43)c3ccccc32)cc1C |
| InChI | InChI=1S/C28H23F3N2O2/c1-17-7-9-21(13-18(17)2)35-12-11-33-16-19(22-5-3-4-6-26(22)33)14-24-23-10-8-20(28(29,30)31)15-25(23)32-27(24)34/h3-10,13-16H,11-12H2,1-2H3,(H,32,34)/b24-14+ |
| InChIKey | GHTNKDKYQDLKBK-ZVHZXABRSA-N |
| XLogP | 6.85 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|