C30H26BrN3O4 — CID 124540600
(5E)-1-benzyl-5-[[5-bromo-1-[2-(3,4-dimethylphenoxy)ethyl]indol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 124540600) has the molecular formula C30H26BrN3O4 and a molecular weight of 572.46 g/mol. Its IUPAC name is (5E)-1-benzyl-5-[[5-bromo-1-[2-(3,4-dimethylphenoxy)ethyl]indol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-benzyl-5-[[5-bromo-1-[2-(3,4-dimethylphenoxy)ethyl]indol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124540600 |
| Molecular Formula | C30H26BrN3O4 |
| Molecular Weight | 572.46 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | (5E)-1-benzyl-5-[[5-bromo-1-[2-(3,4-dimethylphenoxy)ethyl]indol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(OCCn2cc(/C=C3\C(=O)NC(=O)N(Cc4ccccc4)C3=O)c3cc(Br)ccc32)cc1C |
| InChI | InChI=1S/C30H26BrN3O4/c1-19-8-10-24(14-20(19)2)38-13-12-33-18-22(25-16-23(31)9-11-27(25)33)15-26-28(35)32-30(37)34(29(26)36)17-21-6-4-3-5-7-21/h3-11,14-16,18H,12-13,17H2,1-2H3,(H,32,35,37)/b26-15+ |
| InChIKey | IWDVWULFESVHNU-CVKSISIWSA-N |
| XLogP | 5.76 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|