C27H20BrNO3 — CID 126137734
2-[[5-bromo-1-[2-(2-methylphenoxy)ethyl]indol-3-yl]methylidene]indene-1,3-dione (PubChem CID 126137734) has the molecular formula C27H20BrNO3 and a molecular weight of 486.37 g/mol. Its IUPAC name is 2-[[5-bromo-1-[2-(2-methylphenoxy)ethyl]indol-3-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[5-bromo-1-[2-(2-methylphenoxy)ethyl]indol-3-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 126137734 |
| Molecular Formula | C27H20BrNO3 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 2-[[5-bromo-1-[2-(2-methylphenoxy)ethyl]indol-3-yl]methylidene]indene-1,3-dione |
| SMILES | Cc1ccccc1OCCn1cc(C=C2C(=O)c3ccccc3C2=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C27H20BrNO3/c1-17-6-2-5-9-25(17)32-13-12-29-16-18(22-15-19(28)10-11-24(22)29)14-23-26(30)20-7-3-4-8-21(20)27(23)31/h2-11,14-16H,12-13H2,1H3 |
| InChIKey | JJRGTBBDSSMZSL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|