C23H21BrN2O3S — CID 126141970
(5Z)-5-[[5-bromo-1-[2-(2-methylphenoxy)ethyl]indol-3-yl]methylidene]-3-ethyl-1,3-thiazolidine-2,4-dione (PubChem CID 126141970) has the molecular formula C23H21BrN2O3S and a molecular weight of 485.40 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[2-(2-methylphenoxy)ethyl]indol-3-yl]methylidene]-3-ethyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-bromo-1-[2-(2-methylphenoxy)ethyl]indol-3-yl]methylidene]-3-ethyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126141970 |
| Molecular Formula | C23H21BrN2O3S |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[2-(2-methylphenoxy)ethyl]indol-3-yl]methylidene]-3-ethyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCN1C(=O)S/C(=C\c2cn(CCOc3ccccc3C)c3ccc(Br)cc23)C1=O |
| InChI | InChI=1S/C23H21BrN2O3S/c1-3-26-22(27)21(30-23(26)28)12-16-14-25(19-9-8-17(24)13-18(16)19)10-11-29-20-7-5-4-6-15(20)2/h4-9,12-14H,3,10-11H2,1-2H3/b21-12- |
| InChIKey | ZPCWPHQKIRVTQF-MTJSOVHGSA-N |
| XLogP | 5.85 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|