C29H25BrN2O3S — CID 126144362
(5Z)-3-[(4-bromophenyl)methyl]-5-[[1-[3-(2-methylphenoxy)propyl]indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126144362) has the molecular formula C29H25BrN2O3S and a molecular weight of 561.50 g/mol. Its IUPAC name is (5Z)-3-[(4-bromophenyl)methyl]-5-[[1-[3-(2-methylphenoxy)propyl]indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(4-bromophenyl)methyl]-5-[[1-[3-(2-methylphenoxy)propyl]indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126144362 |
| Molecular Formula | C29H25BrN2O3S |
| Molecular Weight | 561.50 g/mol |
| Exact Mass | 560.08 |
| IUPAC Name | (5Z)-3-[(4-bromophenyl)methyl]-5-[[1-[3-(2-methylphenoxy)propyl]indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccccc1OCCCn1cc(/C=C2\SC(=O)N(Cc3ccc(Br)cc3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C29H25BrN2O3S/c1-20-7-2-5-10-26(20)35-16-6-15-31-19-22(24-8-3-4-9-25(24)31)17-27-28(33)32(29(34)36-27)18-21-11-13-23(30)14-12-21/h2-5,7-14,17,19H,6,15-16,18H2,1H3/b27-17- |
| InChIKey | ZPOMGSZKOFRIQC-PKAZHMFMSA-N |
| XLogP | 7.42 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.50 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|