C29H24BrClN2O3S2 — CID 126139952
(5Z)-5-[[5-bromo-1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126139952) has the molecular formula C29H24BrClN2O3S2 and a molecular weight of 628.01 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-bromo-1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126139952 |
| Molecular Formula | C29H24BrClN2O3S2 |
| Molecular Weight | 628.01 g/mol |
| Exact Mass | 626.01 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CN2C(=O)/C(=C/c3cn(CCCOc4ccccc4Cl)c4ccc(Br)cc34)SC2=S)cc1 |
| InChI | InChI=1S/C29H24BrClN2O3S2/c1-35-22-10-7-19(8-11-22)17-33-28(34)27(38-29(33)37)15-20-18-32(25-12-9-21(30)16-23(20)25)13-4-14-36-26-6-3-2-5-24(26)31/h2-3,5-12,15-16,18H,4,13-14,17H2,1H3/b27-15- |
| InChIKey | MUSXNJFYXWRSOK-DICXZTSXSA-N |
| XLogP | 7.94 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.01 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|