C25H22BrClN2O3S2 — CID 126148003
(5Z)-5-[[5-bromo-1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126148003) has the molecular formula C25H22BrClN2O3S2 and a molecular weight of 577.95 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-bromo-1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126148003 |
| Molecular Formula | C25H22BrClN2O3S2 |
| Molecular Weight | 577.95 g/mol |
| Exact Mass | 575.99 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cn(CCOc3ccccc3Cl)c3ccc(Br)cc23)SC(=S)N1C[C@H]1CCCO1 |
| InChI | InChI=1S/C25H22BrClN2O3S2/c26-17-7-8-21-19(13-17)16(14-28(21)9-11-32-22-6-2-1-5-20(22)27)12-23-24(30)29(25(33)34-23)15-18-4-3-10-31-18/h1-2,5-8,12-14,18H,3-4,9-11,15H2/b23-12-/t18-/m1/s1 |
| InChIKey | IRLSMWXSOZFVOQ-OMMIQNFISA-N |
| XLogP | 6.52 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.95 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|