C27H26BrN3O3S2 — CID 126144343
2-[5-bromo-3-[(Z)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 126144343) has the molecular formula C27H26BrN3O3S2 and a molecular weight of 584.56 g/mol. Its IUPAC name is 2-[5-bromo-3-[(Z)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-[5-bromo-3-[(Z)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 126144343 |
| Molecular Formula | C27H26BrN3O3S2 |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 583.06 |
| IUPAC Name | 2-[5-bromo-3-[(Z)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | O=C(Cn1cc(/C=C2\SC(=S)N(CCc3ccccc3)C2=O)c2cc(Br)ccc21)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C27H26BrN3O3S2/c28-20-8-9-23-22(14-20)19(16-30(23)17-25(32)29-15-21-7-4-12-34-21)13-24-26(33)31(27(35)36-24)11-10-18-5-2-1-3-6-18/h1-3,5-6,8-9,13-14,16,21H,4,7,10-12,15,17H2,(H,29,32)/b24-13-/t21-/m0/s1 |
| InChIKey | ZHHCERGAAMQLCA-JWRUUXOFSA-N |
| XLogP | 5.14 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|