C27H22BrN3O3S2 — CID 126151720
2-[5-bromo-3-[(Z)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 126151720) has the molecular formula C27H22BrN3O3S2 and a molecular weight of 580.53 g/mol. Its IUPAC name is 2-[5-bromo-3-[(Z)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[5-bromo-3-[(Z)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 126151720 |
| Molecular Formula | C27H22BrN3O3S2 |
| Molecular Weight | 580.53 g/mol |
| Exact Mass | 579.03 |
| IUPAC Name | 2-[5-bromo-3-[(Z)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1cc(/C=C2\SC(=O)N(CCc3ccccc3)C2=O)c2cc(Br)ccc21)NCc1cccs1 |
| InChI | InChI=1S/C27H22BrN3O3S2/c28-20-8-9-23-22(14-20)19(16-30(23)17-25(32)29-15-21-7-4-12-35-21)13-24-26(33)31(27(34)36-24)11-10-18-5-2-1-3-6-18/h1-9,12-14,16H,10-11,15,17H2,(H,29,32)/b24-13- |
| InChIKey | IEBMMJYJNKLDNA-CFRMEGHHSA-N |
| XLogP | 6.06 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|