C27H20BrFN4O4S2 — CID 126155418
2-[5-bromo-3-[(Z)-[3-[2-(4-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 126155418) has the molecular formula C27H20BrFN4O4S2 and a molecular weight of 627.52 g/mol. Its IUPAC name is 2-[5-bromo-3-[(Z)-[3-[2-(4-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[5-bromo-3-[(Z)-[3-[2-(4-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 126155418 |
| Molecular Formula | C27H20BrFN4O4S2 |
| Molecular Weight | 627.52 g/mol |
| Exact Mass | 626.01 |
| IUPAC Name | 2-[5-bromo-3-[(Z)-[3-[2-(4-fluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(F)cc3)C2=O)c2cc(Br)ccc21)NCc1cccs1 |
| InChI | InChI=1S/C27H20BrFN4O4S2/c28-17-3-8-22-21(11-17)16(13-32(22)14-24(34)30-12-20-2-1-9-38-20)10-23-26(36)33(27(37)39-23)15-25(35)31-19-6-4-18(29)5-7-19/h1-11,13H,12,14-15H2,(H,30,34)(H,31,35)/b23-10- |
| InChIKey | XXIAKURKMLWVDH-RMORIDSASA-N |
| XLogP | 5.60 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|