C24H18BrN3O3S3 — CID 126142684
2-[5-bromo-3-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 126142684) has the molecular formula C24H18BrN3O3S3 and a molecular weight of 572.53 g/mol. Its IUPAC name is 2-[5-bromo-3-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[5-bromo-3-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 126142684 |
| Molecular Formula | C24H18BrN3O3S3 |
| Molecular Weight | 572.53 g/mol |
| Exact Mass | 570.97 |
| IUPAC Name | 2-[5-bromo-3-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1cc(/C=C2\SC(=S)N(Cc3ccco3)C2=O)c2cc(Br)ccc21)NCc1cccs1 |
| InChI | InChI=1S/C24H18BrN3O3S3/c25-16-5-6-20-19(10-16)15(12-27(20)14-22(29)26-11-18-4-2-8-33-18)9-21-23(30)28(24(32)34-21)13-17-3-1-7-31-17/h1-10,12H,11,13-14H2,(H,26,29)/b21-9- |
| InChIKey | SUIZOHBVRAEKTC-NKVSQWTQSA-N |
| XLogP | 5.78 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|