C19H14BrN3O4S — CID 126132598
2-[5-bromo-3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 126132598) has the molecular formula C19H14BrN3O4S and a molecular weight of 460.31 g/mol. Its IUPAC name is 2-[5-bromo-3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[5-bromo-3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 126132598 |
| Molecular Formula | C19H14BrN3O4S |
| Molecular Weight | 460.31 g/mol |
| Exact Mass | 458.99 |
| IUPAC Name | 2-[5-bromo-3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1cc(/C=C2\SC(=O)NC2=O)c2cc(Br)ccc21)NCc1ccco1 |
| InChI | InChI=1S/C19H14BrN3O4S/c20-12-3-4-15-14(7-12)11(6-16-18(25)22-19(26)28-16)9-23(15)10-17(24)21-8-13-2-1-5-27-13/h1-7,9H,8,10H2,(H,21,24)(H,22,25,26)/b16-6- |
| InChIKey | OJVNFKHFQPGLJB-SOFYXZRVSA-N |
| XLogP | 3.64 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|