C26H20FN3O3S2 — CID 126145410
2-[3-[(Z)-[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 126145410) has the molecular formula C26H20FN3O3S2 and a molecular weight of 505.60 g/mol. Its IUPAC name is 2-[3-[(Z)-[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[3-[(Z)-[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 126145410 |
| Molecular Formula | C26H20FN3O3S2 |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 2-[3-[(Z)-[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1cc(/C=C2\SC(=O)N(Cc3ccccc3F)C2=O)c2ccccc21)NCc1cccs1 |
| InChI | InChI=1S/C26H20FN3O3S2/c27-21-9-3-1-6-17(21)15-30-25(32)23(35-26(30)33)12-18-14-29(22-10-4-2-8-20(18)22)16-24(31)28-13-19-7-5-11-34-19/h1-12,14H,13,15-16H2,(H,28,31)/b23-12- |
| InChIKey | MRHIVTAZKROWJF-FMCGGJTJSA-N |
| XLogP | 5.39 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|