C22H21N3O3S2 — CID 126132718
2-[3-[(Z)-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 126132718) has the molecular formula C22H21N3O3S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[3-[(Z)-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[3-[(Z)-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 126132718 |
| Molecular Formula | C22H21N3O3S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 2-[3-[(Z)-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCCN1C(=O)S/C(=C\c2cn(CC(=O)NCc3cccs3)c3ccccc23)C1=O |
| InChI | InChI=1S/C22H21N3O3S2/c1-2-9-25-21(27)19(30-22(25)28)11-15-13-24(18-8-4-3-7-17(15)18)14-20(26)23-12-16-6-5-10-29-16/h3-8,10-11,13H,2,9,12,14H2,1H3,(H,23,26)/b19-11- |
| InChIKey | OTHZGXQFPHZJEB-ODLFYWEKSA-N |
| XLogP | 4.47 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|