C27H20BrFN2O2S — CID 126143453
(5Z)-5-[[5-bromo-1-[(4-fluorophenyl)methyl]indol-3-yl]methylidene]-3-(2-phenylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126143453) has the molecular formula C27H20BrFN2O2S and a molecular weight of 535.44 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[(4-fluorophenyl)methyl]indol-3-yl]methylidene]-3-(2-phenylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-bromo-1-[(4-fluorophenyl)methyl]indol-3-yl]methylidene]-3-(2-phenylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126143453 |
| Molecular Formula | C27H20BrFN2O2S |
| Molecular Weight | 535.44 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[(4-fluorophenyl)methyl]indol-3-yl]methylidene]-3-(2-phenylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cn(Cc3ccc(F)cc3)c3ccc(Br)cc23)C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C27H20BrFN2O2S/c28-21-8-11-24-23(15-21)20(17-30(24)16-19-6-9-22(29)10-7-19)14-25-26(32)31(27(33)34-25)13-12-18-4-2-1-3-5-18/h1-11,14-15,17H,12-13,16H2/b25-14- |
| InChIKey | UGLORTKIOQXFGB-QFEZKATASA-N |
| XLogP | 6.87 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.44 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|