C25H23BrFN3O3S — CID 126142145
2-[5-bromo-3-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N,N-diethylacetamide (PubChem CID 126142145) has the molecular formula C25H23BrFN3O3S and a molecular weight of 544.45 g/mol. Its IUPAC name is 2-[5-bromo-3-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[5-bromo-3-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 126142145 |
| Molecular Formula | C25H23BrFN3O3S |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 543.06 |
| IUPAC Name | 2-[5-bromo-3-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)Cn1cc(/C=C2\SC(=O)N(Cc3ccc(F)cc3)C2=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C25H23BrFN3O3S/c1-3-28(4-2)23(31)15-29-14-17(20-12-18(26)7-10-21(20)29)11-22-24(32)30(25(33)34-22)13-16-5-8-19(27)9-6-16/h5-12,14H,3-4,13,15H2,1-2H3/b22-11- |
| InChIKey | QVNXXUXXVIIVJJ-JJFYIABZSA-N |
| XLogP | 5.65 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|