C22H18Br2ClNO3S2 — CID 126094966
(5Z)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126094966) has the molecular formula C22H18Br2ClNO3S2 and a molecular weight of 603.79 g/mol. Its IUPAC name is (5Z)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126094966 |
| Molecular Formula | C22H18Br2ClNO3S2 |
| Molecular Weight | 603.79 g/mol |
| Exact Mass | 600.88 |
| IUPAC Name | (5Z)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(Br)c(OCc3ccccc3Cl)c(Br)c2)SC(=S)N1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C22H18Br2ClNO3S2/c23-16-8-13(9-17(24)20(16)29-12-14-4-1-2-6-18(14)25)10-19-21(27)26(22(30)31-19)11-15-5-3-7-28-15/h1-2,4,6,8-10,15H,3,5,7,11-12H2/b19-10-/t15-/m0/s1 |
| InChIKey | FWKXEZUGHFGPQP-HNIBHBHRSA-N |
| XLogP | 6.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.79 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|