C24H23BrClNO4S2 — CID 126089351
(5Z)-5-[[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126089351) has the molecular formula C24H23BrClNO4S2 and a molecular weight of 568.94 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126089351 |
| Molecular Formula | C24H23BrClNO4S2 |
| Molecular Weight | 568.94 g/mol |
| Exact Mass | 566.99 |
| IUPAC Name | (5Z)-5-[[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(C[C@H]3CCCO3)C2=O)cc(Br)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H23BrClNO4S2/c1-2-29-20-11-16(10-19(25)22(20)31-14-15-5-3-6-17(26)9-15)12-21-23(28)27(24(32)33-21)13-18-7-4-8-30-18/h3,5-6,9-12,18H,2,4,7-8,13-14H2,1H3/b21-12-/t18-/m1/s1 |
| InChIKey | RPTNODBXTHMERV-UZQMFHLOSA-N |
| XLogP | 6.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.94 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|