C22H18I2N2O5S2 — CID 126085732
(5Z)-5-[[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126085732) has the molecular formula C22H18I2N2O5S2 and a molecular weight of 708.34 g/mol. Its IUPAC name is (5Z)-5-[[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126085732 |
| Molecular Formula | C22H18I2N2O5S2 |
| Molecular Weight | 708.34 g/mol |
| Exact Mass | 707.87 |
| IUPAC Name | (5Z)-5-[[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(I)c(OCc3cccc([N+](=O)[O-])c3)c(I)c2)SC(=S)N1C[C@H]1CCCO1 |
| InChI | InChI=1S/C22H18I2N2O5S2/c23-17-8-14(10-19-21(27)25(22(32)33-19)11-16-5-2-6-30-16)9-18(24)20(17)31-12-13-3-1-4-15(7-13)26(28)29/h1,3-4,7-10,16H,2,5-6,11-12H2/b19-10-/t16-/m1/s1 |
| InChIKey | AYVCUMNDGWAUJP-DZGUVLCISA-N |
| XLogP | 5.76 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.34 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|