C22H19Cl2NO3S2 — CID 126085444
(5Z)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126085444) has the molecular formula C22H19Cl2NO3S2 and a molecular weight of 480.44 g/mol. Its IUPAC name is (5Z)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126085444 |
| Molecular Formula | C22H19Cl2NO3S2 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 479.02 |
| IUPAC Name | (5Z)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccccc2OCc2ccc(Cl)cc2Cl)SC(=S)N1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C22H19Cl2NO3S2/c23-16-8-7-15(18(24)11-16)13-28-19-6-2-1-4-14(19)10-20-21(26)25(22(29)30-20)12-17-5-3-9-27-17/h1-2,4,6-8,10-11,17H,3,5,9,12-13H2/b20-10-/t17-/m0/s1 |
| InChIKey | JQIXPZNLPXQWJT-NAGKPISUSA-N |
| XLogP | 5.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|