C18H15Cl2NO3S2 — CID 126088993
(5Z)-5-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126088993) has the molecular formula C18H15Cl2NO3S2 and a molecular weight of 428.36 g/mol. Its IUPAC name is (5Z)-5-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126088993 |
| Molecular Formula | C18H15Cl2NO3S2 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | (5Z)-5-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C#CCOc1c(Cl)cc(/C=C2\SC(=S)N(C[C@@H]3CCCO3)C2=O)cc1Cl |
| InChI | InChI=1S/C18H15Cl2NO3S2/c1-2-5-24-16-13(19)7-11(8-14(16)20)9-15-17(22)21(18(25)26-15)10-12-4-3-6-23-12/h1,7-9,12H,3-6,10H2/b15-9-/t12-/m0/s1 |
| InChIKey | QKTYTZCSALTJGS-ZENNRRHLSA-N |
| XLogP | 4.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|