C27H18BrCl3N2O3S — CID 126129748
(5Z)-5-[[5-bromo-1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-3-[(2,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126129748) has the molecular formula C27H18BrCl3N2O3S and a molecular weight of 636.78 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-3-[(2,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-bromo-1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-3-[(2,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126129748 |
| Molecular Formula | C27H18BrCl3N2O3S |
| Molecular Weight | 636.78 g/mol |
| Exact Mass | 633.93 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-3-[(2,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cn(CCOc3ccccc3Cl)c3ccc(Br)cc23)C(=O)N1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H18BrCl3N2O3S/c28-18-6-8-23-20(12-18)17(14-32(23)9-10-36-24-4-2-1-3-21(24)30)11-25-26(34)33(27(35)37-25)15-16-5-7-19(29)13-22(16)31/h1-8,11-14H,9-10,15H2/b25-11- |
| InChIKey | BVQKFUSNUPYBGX-GATIEOLUSA-N |
| XLogP | 8.68 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.78 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|