C25H19Cl2NO4S — CID 3636598
3-[(2,4-dichlorophenyl)methyl]-5-[[2-(2-phenoxyethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 3636598) has the molecular formula C25H19Cl2NO4S and a molecular weight of 500.40 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methyl]-5-[[2-(2-phenoxyethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(2,4-dichlorophenyl)methyl]-5-[[2-(2-phenoxyethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3636598 |
| Molecular Formula | C25H19Cl2NO4S |
| Molecular Weight | 500.40 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methyl]-5-[[2-(2-phenoxyethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccccc2OCCOc2ccccc2)C(=O)N1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H19Cl2NO4S/c26-19-11-10-18(21(27)15-19)16-28-24(29)23(33-25(28)30)14-17-6-4-5-9-22(17)32-13-12-31-20-7-2-1-3-8-20/h1-11,14-15H,12-13,16H2 |
| InChIKey | ABPAPWRXDXEBME-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.40 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|