C25H19Cl2NO3S — CID 124665294
(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-[(3-methylphenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 124665294) has the molecular formula C25H19Cl2NO3S and a molecular weight of 484.40 g/mol. Its IUPAC name is (5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-[(3-methylphenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-[(3-methylphenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124665294 |
| Molecular Formula | C25H19Cl2NO3S |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | (5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-[(3-methylphenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cccc(CN2C(=O)S/C(=C/c3ccccc3OCc3ccc(Cl)cc3Cl)C2=O)c1 |
| InChI | InChI=1S/C25H19Cl2NO3S/c1-16-5-4-6-17(11-16)14-28-24(29)23(32-25(28)30)12-18-7-2-3-8-22(18)31-15-19-9-10-20(26)13-21(19)27/h2-13H,14-15H2,1H3/b23-12+ |
| InChIKey | NIRAFIGVORMIOZ-FSJBWODESA-N |
| XLogP | 7.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.40 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|