C23H19BrCl2N2O2S — CID 126145784
(5Z)-5-[[5-bromo-1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-(2-methylpropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126145784) has the molecular formula C23H19BrCl2N2O2S and a molecular weight of 538.29 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-(2-methylpropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-bromo-1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-(2-methylpropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126145784 |
| Molecular Formula | C23H19BrCl2N2O2S |
| Molecular Weight | 538.29 g/mol |
| Exact Mass | 535.97 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-(2-methylpropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)CN1C(=O)S/C(=C\c2cn(Cc3ccc(Cl)cc3Cl)c3ccc(Br)cc23)C1=O |
| InChI | InChI=1S/C23H19BrCl2N2O2S/c1-13(2)10-28-22(29)21(31-23(28)30)7-15-12-27(20-6-4-16(24)8-18(15)20)11-14-3-5-17(25)9-19(14)26/h3-9,12-13H,10-11H2,1-2H3/b21-7- |
| InChIKey | NYATXKXYLGRGEL-YXSASFKJSA-N |
| XLogP | 7.45 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.29 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|