C23H21BrClN3O2S — CID 126145201
(5Z)-5-[[5-bromo-1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126145201) has the molecular formula C23H21BrClN3O2S and a molecular weight of 518.86 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[5-bromo-1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126145201 |
| Molecular Formula | C23H21BrClN3O2S |
| Molecular Weight | 518.86 g/mol |
| Exact Mass | 517.02 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2cn(CCCOc3ccccc3Cl)c3ccc(Br)cc23)NC1=S |
| InChI | InChI=1S/C23H21BrClN3O2S/c1-2-28-22(29)19(26-23(28)31)12-15-14-27(20-9-8-16(24)13-17(15)20)10-5-11-30-21-7-4-3-6-18(21)25/h3-4,6-9,12-14H,2,5,10-11H2,1H3,(H,26,31)/b19-12- |
| InChIKey | JQCISBWWSJLNPZ-UNOMPAQXSA-N |
| XLogP | 5.60 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.86 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|