C25H18Cl2N2O2 — CID 21370122
(3E)-6-chloro-3-[[1-[2-(4-chlorophenoxy)ethyl]indol-3-yl]methylidene]-1H-indol-2-one (PubChem CID 21370122) has the molecular formula C25H18Cl2N2O2 and a molecular weight of 449.34 g/mol. Its IUPAC name is (3E)-6-chloro-3-[[1-[2-(4-chlorophenoxy)ethyl]indol-3-yl]methylidene]-1H-indol-2-one.
| Compound Name | (3E)-6-chloro-3-[[1-[2-(4-chlorophenoxy)ethyl]indol-3-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 21370122 |
| Molecular Formula | C25H18Cl2N2O2 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | (3E)-6-chloro-3-[[1-[2-(4-chlorophenoxy)ethyl]indol-3-yl]methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2cc(Cl)ccc2/C1=C\c1cn(CCOc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H18Cl2N2O2/c26-17-5-8-19(9-6-17)31-12-11-29-15-16(20-3-1-2-4-24(20)29)13-22-21-10-7-18(27)14-23(21)28-25(22)30/h1-10,13-15H,11-12H2,(H,28,30)/b22-13+ |
| InChIKey | OURGVDWMYVGSNK-LPYMAVHISA-N |
| XLogP | 6.52 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|