C23H20ClN3O3 — CID 3648769
6-chloro-3-[[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-1H-indol-2-one (PubChem CID 3648769) has the molecular formula C23H20ClN3O3 and a molecular weight of 421.88 g/mol. Its IUPAC name is 6-chloro-3-[[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-1H-indol-2-one.
| Compound Name | 6-chloro-3-[[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 3648769 |
| Molecular Formula | C23H20ClN3O3 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 6-chloro-3-[[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2cc(Cl)ccc2C1=Cc1cn(CC(=O)N2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C23H20ClN3O3/c24-16-5-6-18-19(23(29)25-20(18)12-16)11-15-13-27(21-4-2-1-3-17(15)21)14-22(28)26-7-9-30-10-8-26/h1-6,11-13H,7-10,14H2,(H,25,29) |
| InChIKey | MWXFFOKRVKUAMC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|