C27H26N4O4S — CID 4272060
1-(2-ethylphenyl)-5-[[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 4272060) has the molecular formula C27H26N4O4S and a molecular weight of 502.60 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-5-[[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-(2-ethylphenyl)-5-[[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 4272060 |
| Molecular Formula | C27H26N4O4S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 1-(2-ethylphenyl)-5-[[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCc1ccccc1N1C(=O)C(=Cc2cn(CC(=O)N3CCOCC3)c3ccccc23)C(=O)NC1=S |
| InChI | InChI=1S/C27H26N4O4S/c1-2-18-7-3-5-9-22(18)31-26(34)21(25(33)28-27(31)36)15-19-16-30(23-10-6-4-8-20(19)23)17-24(32)29-11-13-35-14-12-29/h3-10,15-16H,2,11-14,17H2,1H3,(H,28,33,36) |
| InChIKey | DEXGSZXUAMEZOI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|