C23H19N3O4S — CID 1006105
2-[3-[[1-(2,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]acetic acid (PubChem CID 1006105) has the molecular formula C23H19N3O4S and a molecular weight of 433.49 g/mol. Its IUPAC name is 2-[3-[[1-(2,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[[1-(2,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 1006105 |
| Molecular Formula | C23H19N3O4S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 2-[3-[[1-(2,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]acetic acid |
| SMILES | Cc1ccc(N2C(=O)C(=Cc3cn(CC(=O)O)c4ccccc34)C(=O)NC2=S)c(C)c1 |
| InChI | InChI=1S/C23H19N3O4S/c1-13-7-8-18(14(2)9-13)26-22(30)17(21(29)24-23(26)31)10-15-11-25(12-20(27)28)19-6-4-3-5-16(15)19/h3-11H,12H2,1-2H3,(H,27,28)(H,24,29,31) |
| InChIKey | FFHIGMAYHJHQHL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|