C28H21Cl2N3O2S — CID 126238405
(5E)-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-1-(2,5-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126238405) has the molecular formula C28H21Cl2N3O2S and a molecular weight of 534.47 g/mol. Its IUPAC name is (5E)-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-1-(2,5-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-1-(2,5-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126238405 |
| Molecular Formula | C28H21Cl2N3O2S |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | (5E)-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-1-(2,5-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1ccc(C)c(N2C(=O)/C(=C/c3cn(Cc4ccc(Cl)c(Cl)c4)c4ccccc34)C(=O)NC2=S)c1 |
| InChI | InChI=1S/C28H21Cl2N3O2S/c1-16-7-8-17(2)25(11-16)33-27(35)21(26(34)31-28(33)36)13-19-15-32(24-6-4-3-5-20(19)24)14-18-9-10-22(29)23(30)12-18/h3-13,15H,14H2,1-2H3,(H,31,34,36)/b21-13+ |
| InChIKey | PAOUJCSJVBBSSB-FYJGNVAPSA-N |
| XLogP | 6.44 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|