C32H25N3O2S — CID 126246585
(5E)-1-(2,5-dimethylphenyl)-5-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126246585) has the molecular formula C32H25N3O2S and a molecular weight of 515.64 g/mol. Its IUPAC name is (5E)-1-(2,5-dimethylphenyl)-5-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-1-(2,5-dimethylphenyl)-5-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126246585 |
| Molecular Formula | C32H25N3O2S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | (5E)-1-(2,5-dimethylphenyl)-5-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1ccc(C)c(N2C(=O)/C(=C/c3cn(Cc4ccc5ccccc5c4)c4ccccc34)C(=O)NC2=S)c1 |
| InChI | InChI=1S/C32H25N3O2S/c1-20-11-12-21(2)29(15-20)35-31(37)27(30(36)33-32(35)38)17-25-19-34(28-10-6-5-9-26(25)28)18-22-13-14-23-7-3-4-8-24(23)16-22/h3-17,19H,18H2,1-2H3,(H,33,36,38)/b27-17+ |
| InChIKey | KIJAZQSFEGFBPD-WPWMEQJKSA-N |
| XLogP | 6.29 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|