C20H12F3NO — CID 126112448
(3Z)-3-(naphthalen-1-ylmethylidene)-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 126112448) has the molecular formula C20H12F3NO and a molecular weight of 339.32 g/mol. Its IUPAC name is (3Z)-3-(naphthalen-1-ylmethylidene)-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3Z)-3-(naphthalen-1-ylmethylidene)-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 126112448 |
| Molecular Formula | C20H12F3NO |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (3Z)-3-(naphthalen-1-ylmethylidene)-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | O=C1Nc2cc(C(F)(F)F)ccc2/C1=C/c1cccc2ccccc12 |
| InChI | InChI=1S/C20H12F3NO/c21-20(22,23)14-8-9-16-17(19(25)24-18(16)11-14)10-13-6-3-5-12-4-1-2-7-15(12)13/h1-11H,(H,24,25)/b17-10- |
| InChIKey | MJYMFLYBDOSBNF-YVLHZVERSA-N |
| XLogP | 5.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|