C19H17F3N2O — CID 955231
(3E)-3-[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 955231) has the molecular formula C19H17F3N2O and a molecular weight of 346.35 g/mol. Its IUPAC name is (3E)-3-[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3E)-3-[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 955231 |
| Molecular Formula | C19H17F3N2O |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (3E)-3-[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | Cc1cc(/C=C2/C(=O)Nc3cc(C(F)(F)F)ccc32)c(C)n1C1CC1 |
| InChI | InChI=1S/C19H17F3N2O/c1-10-7-12(11(2)24(10)14-4-5-14)8-16-15-6-3-13(19(20,21)22)9-17(15)23-18(16)25/h3,6-9,14H,4-5H2,1-2H3,(H,23,25)/b16-8+ |
| InChIKey | JQTJIOMUTICYCF-LZYBPNLTSA-N |
| XLogP | 4.95 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|