C23H18BrF3N2O — CID 21374140
(3E)-3-[[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 21374140) has the molecular formula C23H18BrF3N2O and a molecular weight of 475.31 g/mol. Its IUPAC name is (3E)-3-[[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3E)-3-[[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 21374140 |
| Molecular Formula | C23H18BrF3N2O |
| Molecular Weight | 475.31 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | (3E)-3-[[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | Cc1cc(-n2c(C)cc(/C=C3/C(=O)Nc4cc(C(F)(F)F)ccc43)c2C)ccc1Br |
| InChI | InChI=1S/C23H18BrF3N2O/c1-12-8-17(5-7-20(12)24)29-13(2)9-15(14(29)3)10-19-18-6-4-16(23(25,26)27)11-21(18)28-22(19)30/h4-11H,1-3H3,(H,28,30)/b19-10+ |
| InChIKey | SATMKFMNWDQHJB-VXLYETTFSA-N |
| XLogP | 6.68 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.31 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|