C23H19BrFN3OS — CID 135642516
(5E)-5-[[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135642516) has the molecular formula C23H19BrFN3OS and a molecular weight of 484.39 g/mol. Its IUPAC name is (5E)-5-[[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135642516 |
| Molecular Formula | C23H19BrFN3OS |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | (5E)-5-[[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(-n2c(C)cc(/C=C3/S/C(=N\c4ccc(F)cc4)NC3=O)c2C)ccc1Br |
| InChI | InChI=1S/C23H19BrFN3OS/c1-13-10-19(8-9-20(13)24)28-14(2)11-16(15(28)3)12-21-22(29)27-23(30-21)26-18-6-4-17(25)5-7-18/h4-12H,1-3H3,(H,26,27,29)/b21-12+ |
| InChIKey | PEERJCAJHOPFAH-CIAFOILYSA-N |
| XLogP | 6.20 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|