C29H25N3OS — CID 136689327
(5Z)-5-[[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 136689327) has the molecular formula C29H25N3OS and a molecular weight of 463.61 g/mol. Its IUPAC name is (5Z)-5-[[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136689327 |
| Molecular Formula | C29H25N3OS |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (5Z)-5-[[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2\NC(=O)/C(=C/c3cc(C)n(-c4ccc(-c5ccccc5)cc4)c3C)S2)cc1 |
| InChI | InChI=1S/C29H25N3OS/c1-19-9-13-25(14-10-19)30-29-31-28(33)27(34-29)18-24-17-20(2)32(21(24)3)26-15-11-23(12-16-26)22-7-5-4-6-8-22/h4-18H,1-3H3,(H,30,31,33)/b27-18- |
| InChIKey | NVOROSQLQBNSMC-IMRQLAEWSA-N |
| XLogP | 6.96 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|