C30H27N3O2S — CID 137064981
(5E)-5-[[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylidene]-2-(4-ethoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137064981) has the molecular formula C30H27N3O2S and a molecular weight of 493.63 g/mol. Its IUPAC name is (5E)-5-[[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylidene]-2-(4-ethoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylidene]-2-(4-ethoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137064981 |
| Molecular Formula | C30H27N3O2S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | (5E)-5-[[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylidene]-2-(4-ethoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(/N=C2/NC(=O)/C(=C\c3cc(C)n(-c4ccc(-c5ccccc5)cc4)c3C)S2)cc1 |
| InChI | InChI=1S/C30H27N3O2S/c1-4-35-27-16-12-25(13-17-27)31-30-32-29(34)28(36-30)19-24-18-20(2)33(21(24)3)26-14-10-23(11-15-26)22-8-6-5-7-9-22/h5-19H,4H2,1-3H3,(H,31,32,34)/b28-19+ |
| InChIKey | IUKNIIJOHBCTBV-TURZUDJPSA-N |
| XLogP | 7.05 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|