C25H25N3OS — CID 135445025
5-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylidene]-2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135445025) has the molecular formula C25H25N3OS and a molecular weight of 415.56 g/mol. Its IUPAC name is 5-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylidene]-2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylidene]-2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135445025 |
| Molecular Formula | C25H25N3OS |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 5-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylidene]-2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(-n2c(C)cc(C=C3S/C(=N\c4cc(C)cc(C)c4)NC3=O)c2C)cc1 |
| InChI | InChI=1S/C25H25N3OS/c1-15-6-8-22(9-7-15)28-18(4)13-20(19(28)5)14-23-24(29)27-25(30-23)26-21-11-16(2)10-17(3)12-21/h6-14H,1-5H3,(H,26,27,29) |
| InChIKey | QBASJMPBROYZJY-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|