C26H28N4OS — CID 137064935
(5E)-5-[[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2-(3,4-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137064935) has the molecular formula C26H28N4OS and a molecular weight of 444.60 g/mol. Its IUPAC name is (5E)-5-[[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2-(3,4-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2-(3,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137064935 |
| Molecular Formula | C26H28N4OS |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (5E)-5-[[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2-(3,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2/NC(=O)/C(=C\c3cc(C)n(-c4ccc(N(C)C)cc4)c3C)S2)cc1C |
| InChI | InChI=1S/C26H28N4OS/c1-16-7-8-21(13-17(16)2)27-26-28-25(31)24(32-26)15-20-14-18(3)30(19(20)4)23-11-9-22(10-12-23)29(5)6/h7-15H,1-6H3,(H,27,28,31)/b24-15+ |
| InChIKey | KBXFHURNQUXBSD-BUVRLJJBSA-N |
| XLogP | 5.67 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|