C25H24BrN3O2S — CID 137021050
(5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137021050) has the molecular formula C25H24BrN3O2S and a molecular weight of 510.46 g/mol. Its IUPAC name is (5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137021050 |
| Molecular Formula | C25H24BrN3O2S |
| Molecular Weight | 510.46 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | (5Z)-2-(4-bromo-3,5-dimethylphenyl)imino-5-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(-n2c(C)cc(/C=C3\S/C(=N\c4cc(C)c(Br)c(C)c4)NC3=O)c2C)cc1 |
| InChI | InChI=1S/C25H24BrN3O2S/c1-14-10-19(11-15(2)23(14)26)27-25-28-24(30)22(32-25)13-18-12-16(3)29(17(18)4)20-6-8-21(31-5)9-7-20/h6-13H,1-5H3,(H,27,28,30)/b22-13- |
| InChIKey | BALIAYLODKLZBM-XKZIYDEJSA-N |
| XLogP | 6.37 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.46 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|